benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate

C14H13NO2S — CID 134448060

IUPACbenzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate
SMILESO=C(OCc1ccccc1)C1CCc2scnc21
InChIInChI=1S/C14H13NO2S/c16-14(17-8-10-4-2-1-3-5-10)11-6-7-12-13(11)15-9-18-12/h1-5,9,11H,6-8H2
InChIKeyUGQUWNMUCMXPNJ-UHFFFAOYSA-N
MW259.33 g/mol
LogP2.92
Rot. Bonds3

About benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate

benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate (PubChem CID 134448060) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate.

Molecular Properties

Compound Namebenzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate
PubChem CID134448060
Molecular FormulaC14H13NO2S
Molecular Weight259.33 g/mol
Exact Mass259.07
IUPAC Namebenzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate
SMILESO=C(OCc1ccccc1)C1CCc2scnc21
InChIInChI=1S/C14H13NO2S/c16-14(17-8-10-4-2-1-3-5-10)11-6-7-12-13(11)15-9-18-12/h1-5,9,11H,6-8H2
InChIKeyUGQUWNMUCMXPNJ-UHFFFAOYSA-N
XLogP2.92
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.33
LogP ≤ 52.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate?
The IUPAC name of benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate (CID 134448060) is benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate.
What is the SMILES notation for benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate?
The canonical SMILES for benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate is O=C(OCc1ccccc1)C1CCc2scnc21.
What is the InChIKey of benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate?
The InChIKey is UGQUWNMUCMXPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2S/c16-14(17-8-10-4-2-1-3-5-10)11-6-7-12-13(11)15-9-18-12/h1-5,9,11H,6-8H2.
What are the key properties of benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate?
benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate has a molecular weight of 259.33 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylate is sourced from PubChem (CID 134448060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).