About (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne
(7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne (PubChem CID 134448970) has the molecular formula C8H8ClN
and a molecular weight of 153.61 g/mol. Its IUPAC name is (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne.
Molecular Properties
| Compound Name | (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne |
| PubChem CID | 134448970 |
| Molecular Formula | C8H8ClN |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne |
| SMILES | CC1=CC#C[C@H](Cl)N=C1C |
| InChI | InChI=1S/C8H8ClN/c1-6-4-3-5-8(9)10-7(6)2/h4,8H,1-2H3/t8-/m1/s1 |
| InChIKey | SBYQXFDSRXHJQH-MRVPVSSYSA-N |
| XLogP | 1.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne?
The IUPAC name of (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne (CID 134448970) is (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne.
What is the SMILES notation for (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne?
The canonical SMILES for (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne is CC1=CC#C[C@H](Cl)N=C1C.
What is the InChIKey of (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne?
The InChIKey is SBYQXFDSRXHJQH-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H8ClN/c1-6-4-3-5-8(9)10-7(6)2/h4,8H,1-2H3/t8-/m1/s1.
What are the key properties of (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne?
(7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne has a molecular weight of 153.61 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-chloro-2,3-dimethyl-1-azacyclohepta-1,3-dien-5-yne is sourced from PubChem (CID 134448970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).