C11H18ClN — CID 123291843
(3E)-N-(2-chloropropyl)-4-methylhepta-3,6-dien-2-imine (PubChem CID 123291843) has the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. Its IUPAC name is (3E)-N-(2-chloropropyl)-4-methylhepta-3,6-dien-2-imine.
| Compound Name | (3E)-N-(2-chloropropyl)-4-methylhepta-3,6-dien-2-imine |
|---|---|
| PubChem CID | 123291843 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | (3E)-N-(2-chloropropyl)-4-methylhepta-3,6-dien-2-imine |
| SMILES | C=CC/C(C)=C/C(C)=N/CC(C)Cl |
| InChI | InChI=1S/C11H18ClN/c1-5-6-9(2)7-11(4)13-8-10(3)12/h5,7,10H,1,6,8H2,2-4H3/b9-7+,13-11+ |
| InChIKey | GNSIIGNOBZEKPR-PTSVWTKZSA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|