C14H20ClN — CID 143455180
(3E,5E,7E)-9-chloro-N-ethenyl-4,5,8-trimethylnona-3,5,7-trien-2-imine (PubChem CID 143455180) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is (3E,5E,7E)-9-chloro-N-ethenyl-4,5,8-trimethylnona-3,5,7-trien-2-imine.
| Compound Name | (3E,5E,7E)-9-chloro-N-ethenyl-4,5,8-trimethylnona-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 143455180 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (3E,5E,7E)-9-chloro-N-ethenyl-4,5,8-trimethylnona-3,5,7-trien-2-imine |
| SMILES | C=C/N=C(C)/C=C(C)/C(C)=C/C=C(\C)CCl |
| InChI | InChI=1S/C14H20ClN/c1-6-16-14(5)9-13(4)12(3)8-7-11(2)10-15/h6-9H,1,10H2,2-5H3/b11-7+,12-8+,13-9+,16-14+ |
| InChIKey | GCYWGTUZNQPTIW-GKJVILCVSA-N |
| XLogP | 4.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|