C13H25N — CID 145193184
ethane;(3Z)-N-ethenyl-3-methylhexa-3,5-dien-2-imine (PubChem CID 145193184) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is ethane;(3Z)-N-ethenyl-3-methylhexa-3,5-dien-2-imine.
| Compound Name | ethane;(3Z)-N-ethenyl-3-methylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 145193184 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | ethane;(3Z)-N-ethenyl-3-methylhexa-3,5-dien-2-imine |
| SMILES | C=C/C=C(C)\C(C)=N\C=C.CC.CC |
| InChI | InChI=1S/C9H13N.2C2H6/c1-5-7-8(3)9(4)10-6-2;2*1-2/h5-7H,1-2H2,3-4H3;2*1-2H3/b8-7-,10-9+;; |
| InChIKey | HWUVPLSBJGXUGO-MURMZTFFSA-N |
| XLogP | 4.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|