C12H20ClN — CID 143344511
(Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride;ethane (PubChem CID 143344511) has the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. Its IUPAC name is (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride;ethane.
| Compound Name | (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride;ethane |
|---|---|
| PubChem CID | 143344511 |
| Molecular Formula | C12H20ClN |
| Molecular Weight | 213.75 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride;ethane |
| SMILES | C=C/N=C(Cl)/C=C(\C=C)CCC.CC |
| InChI | InChI=1S/C10H14ClN.C2H6/c1-4-7-9(5-2)8-10(11)12-6-3;1-2/h5-6,8H,2-4,7H2,1H3;1-2H3/b9-8+,12-10-; |
| InChIKey | IFFZBHLAVXOAJP-WXZZQRGHSA-N |
| XLogP | 4.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.75 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|