C15H23N — CID 123294669
N-[(1Z)-3-ethyl-4-methyl-2-prop-1-enylhepta-1,3,6-trienyl]ethanimine (PubChem CID 123294669) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-[(1Z)-3-ethyl-4-methyl-2-prop-1-enylhepta-1,3,6-trienyl]ethanimine.
| Compound Name | N-[(1Z)-3-ethyl-4-methyl-2-prop-1-enylhepta-1,3,6-trienyl]ethanimine |
|---|---|
| PubChem CID | 123294669 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-[(1Z)-3-ethyl-4-methyl-2-prop-1-enylhepta-1,3,6-trienyl]ethanimine |
| SMILES | C=CCC(C)=C(CC)/C(C=CC)=C\N=C\C |
| InChI | InChI=1S/C15H23N/c1-6-10-13(5)15(8-3)14(11-7-2)12-16-9-4/h6-7,9,11-12H,1,8,10H2,2-5H3/b11-7?,14-12-,15-13?,16-9+ |
| InChIKey | NNBVGDDRJCWWGT-OTDQXZMWSA-N |
| XLogP | 4.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|