C10H13ClF3N — CID 171558541
N-[(1Z,3Z)-3-(trifluoromethyl)hepta-1,3-dienyl]ethanimidoyl chloride (PubChem CID 171558541) has the molecular formula C10H13ClF3N and a molecular weight of 239.67 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-(trifluoromethyl)hepta-1,3-dienyl]ethanimidoyl chloride.
| Compound Name | N-[(1Z,3Z)-3-(trifluoromethyl)hepta-1,3-dienyl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 171558541 |
| Molecular Formula | C10H13ClF3N |
| Molecular Weight | 239.67 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-[(1Z,3Z)-3-(trifluoromethyl)hepta-1,3-dienyl]ethanimidoyl chloride |
| SMILES | CCC/C=C(/C=C\N=C(/C)Cl)C(F)(F)F |
| InChI | InChI=1S/C10H13ClF3N/c1-3-4-5-9(10(12,13)14)6-7-15-8(2)11/h5-7H,3-4H2,1-2H3/b7-6-,9-5-,15-8+ |
| InChIKey | GSPFUCUXEFQRTR-YBEFXHKQSA-N |
| XLogP | 4.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|