C9H11ClF3N — CID 177204371
N-[(1Z,3Z)-3-chloro-2-(trifluoromethyl)hepta-1,3-dienyl]methanimine (PubChem CID 177204371) has the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-chloro-2-(trifluoromethyl)hepta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-3-chloro-2-(trifluoromethyl)hepta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 177204371 |
| Molecular Formula | C9H11ClF3N |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | N-[(1Z,3Z)-3-chloro-2-(trifluoromethyl)hepta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(C(\Cl)=C\CCC)/C(F)(F)F |
| InChI | InChI=1S/C9H11ClF3N/c1-3-4-5-8(10)7(6-14-2)9(11,12)13/h5-6H,2-4H2,1H3/b7-6+,8-5- |
| InChIKey | GGBDVFXKTAQXAS-NGWHPUCNSA-N |
| XLogP | 4.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|