C8H11F2N — CID 171057010
N-[(1E,3E)-5,5-difluoro-2,4-dimethylpenta-1,3-dienyl]methanimine (PubChem CID 171057010) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is N-[(1E,3E)-5,5-difluoro-2,4-dimethylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-5,5-difluoro-2,4-dimethylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 171057010 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | N-[(1E,3E)-5,5-difluoro-2,4-dimethylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(C)/C=C(\C)C(F)F |
| InChI | InChI=1S/C8H11F2N/c1-6(5-11-3)4-7(2)8(9)10/h4-5,8H,3H2,1-2H3/b6-5+,7-4+ |
| InChIKey | DQPUORYXOWKVPX-HVUXDCMCSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|