C10H13ClF3N — CID 146626737
N-[(3E,5Z)-4-chloro-2-methyl-5-(trifluoromethyl)hepta-3,5-dien-3-yl]methanimine (PubChem CID 146626737) has the molecular formula C10H13ClF3N and a molecular weight of 239.67 g/mol. Its IUPAC name is N-[(3E,5Z)-4-chloro-2-methyl-5-(trifluoromethyl)hepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E,5Z)-4-chloro-2-methyl-5-(trifluoromethyl)hepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 146626737 |
| Molecular Formula | C10H13ClF3N |
| Molecular Weight | 239.67 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-[(3E,5Z)-4-chloro-2-methyl-5-(trifluoromethyl)hepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C(Cl)\C(=C/C)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H13ClF3N/c1-5-7(10(12,13)14)8(11)9(15-4)6(2)3/h5-6H,4H2,1-3H3/b7-5+,9-8+ |
| InChIKey | KPJHOZYLVYFKIF-ZIRGRKGMSA-N |
| XLogP | 4.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|