C8H11ClFN — CID 134178760
N-[(3Z)-2-chloro-4-fluoro-2-methylhexa-3,5-dien-3-yl]methanimine (PubChem CID 134178760) has the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. Its IUPAC name is N-[(3Z)-2-chloro-4-fluoro-2-methylhexa-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3Z)-2-chloro-4-fluoro-2-methylhexa-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 134178760 |
| Molecular Formula | C8H11ClFN |
| Molecular Weight | 175.63 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | N-[(3Z)-2-chloro-4-fluoro-2-methylhexa-3,5-dien-3-yl]methanimine |
| SMILES | C=C/C(F)=C(/N=C)C(C)(C)Cl |
| InChI | InChI=1S/C8H11ClFN/c1-5-6(10)7(11-4)8(2,3)9/h5H,1,4H2,2-3H3/b7-6- |
| InChIKey | OIFUMFYKZMOQRI-SREVYHEPSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|