C10H14F3N — CID 163448691
N-[(3Z,5E)-7,7,7-trifluoro-4,6-dimethylhepta-3,5-dien-3-yl]methanimine (PubChem CID 163448691) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is N-[(3Z,5E)-7,7,7-trifluoro-4,6-dimethylhepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3Z,5E)-7,7,7-trifluoro-4,6-dimethylhepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 163448691 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-[(3Z,5E)-7,7,7-trifluoro-4,6-dimethylhepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(CC)=C(C)\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-5-9(14-4)7(2)6-8(3)10(11,12)13/h6H,4-5H2,1-3H3/b8-6+,9-7- |
| InChIKey | BESLRICQZHYABD-FFELTBSMSA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|