C15H22FN — CID 123150964
N-(9-fluoro-2,4,6-trimethyl-5-methylidenedeca-3,6,8-trien-3-yl)methanimine (PubChem CID 123150964) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is N-(9-fluoro-2,4,6-trimethyl-5-methylidenedeca-3,6,8-trien-3-yl)methanimine.
| Compound Name | N-(9-fluoro-2,4,6-trimethyl-5-methylidenedeca-3,6,8-trien-3-yl)methanimine |
|---|---|
| PubChem CID | 123150964 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-(9-fluoro-2,4,6-trimethyl-5-methylidenedeca-3,6,8-trien-3-yl)methanimine |
| SMILES | C=NC(=C(C)C(=C)C(C)=CC=C(C)F)C(C)C |
| InChI | InChI=1S/C15H22FN/c1-10(2)15(17-7)14(6)13(5)11(3)8-9-12(4)16/h8-10H,5,7H2,1-4,6H3 |
| InChIKey | CLSCLHHZMZNJJN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|