C16H24FN — CID 123417513
N-(5-ethylidene-9-fluoro-2,4,6-trimethyldeca-3,6,8-trien-3-yl)methanimine (PubChem CID 123417513) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is N-(5-ethylidene-9-fluoro-2,4,6-trimethyldeca-3,6,8-trien-3-yl)methanimine.
| Compound Name | N-(5-ethylidene-9-fluoro-2,4,6-trimethyldeca-3,6,8-trien-3-yl)methanimine |
|---|---|
| PubChem CID | 123417513 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | N-(5-ethylidene-9-fluoro-2,4,6-trimethyldeca-3,6,8-trien-3-yl)methanimine |
| SMILES | C=NC(=C(C)C(=CC)C(C)=CC=C(C)F)C(C)C |
| InChI | InChI=1S/C16H24FN/c1-8-15(12(4)9-10-13(5)17)14(6)16(18-7)11(2)3/h8-11H,7H2,1-6H3 |
| InChIKey | ICKGQVPFZDYTCV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|