C9H12F3N — CID 142387946
N-[(3E)-2-methyl-4-(trifluoromethyl)hexa-3,5-dien-3-yl]methanimine (PubChem CID 142387946) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is N-[(3E)-2-methyl-4-(trifluoromethyl)hexa-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E)-2-methyl-4-(trifluoromethyl)hexa-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 142387946 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | N-[(3E)-2-methyl-4-(trifluoromethyl)hexa-3,5-dien-3-yl]methanimine |
| SMILES | C=C/C(=C(\N=C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-5-7(9(10,11)12)8(13-4)6(2)3/h5-6H,1,4H2,2-3H3/b8-7+ |
| InChIKey | JJNRVRGDPFERAP-BQYQJAHWSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|