ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride

C13H24ClN — CID 143343534

IUPACethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride
SMILESC/C=C(\C=C/N=C(\C)Cl)CCCC.CC
InChIInChI=1S/C11H18ClN.C2H6/c1-4-6-7-11(5-2)8-9-13-10(3)12;1-2/h5,8-9H,4,6-7H2,1-3H3;1-2H3/b9-8-,11-5-,13-10+;
InChIKeyVBUVOOXRFBQXTA-HKJXASLCSA-N
MW229.80 g/mol
LogP5.32
Rot. Bonds5

About ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride

ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride (PubChem CID 143343534) has the molecular formula C13H24ClN and a molecular weight of 229.80 g/mol. Its IUPAC name is ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride.

Molecular Properties

Compound Nameethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride
PubChem CID143343534
Molecular FormulaC13H24ClN
Molecular Weight229.80 g/mol
Exact Mass229.16
IUPAC Nameethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride
SMILESC/C=C(\C=C/N=C(\C)Cl)CCCC.CC
InChIInChI=1S/C11H18ClN.C2H6/c1-4-6-7-11(5-2)8-9-13-10(3)12;1-2/h5,8-9H,4,6-7H2,1-3H3;1-2H3/b9-8-,11-5-,13-10+;
InChIKeyVBUVOOXRFBQXTA-HKJXASLCSA-N
XLogP5.32
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500229.80
LogP ≤ 55.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride?
The IUPAC name of ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride (CID 143343534) is ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride.
What is the SMILES notation for ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride?
The canonical SMILES for ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride is C/C=C(\C=C/N=C(\C)Cl)CCCC.CC.
What is the InChIKey of ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride?
The InChIKey is VBUVOOXRFBQXTA-HKJXASLCSA-N. The full InChI is InChI=1S/C11H18ClN.C2H6/c1-4-6-7-11(5-2)8-9-13-10(3)12;1-2/h5,8-9H,4,6-7H2,1-3H3;1-2H3/b9-8-,11-5-,13-10+;.
What are the key properties of ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride?
ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride has a molecular weight of 229.80 g/mol, XLogP of 5.32, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride is sourced from PubChem (CID 143343534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).