C13H24ClN — CID 143343534
ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride (PubChem CID 143343534) has the molecular formula C13H24ClN and a molecular weight of 229.80 g/mol. Its IUPAC name is ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride.
| Compound Name | ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 143343534 |
| Molecular Formula | C13H24ClN |
| Molecular Weight | 229.80 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | ethane;N-[(Z,3Z)-3-ethylidenehept-1-enyl]ethanimidoyl chloride |
| SMILES | C/C=C(\C=C/N=C(\C)Cl)CCCC.CC |
| InChI | InChI=1S/C11H18ClN.C2H6/c1-4-6-7-11(5-2)8-9-13-10(3)12;1-2/h5,8-9H,4,6-7H2,1-3H3;1-2H3/b9-8-,11-5-,13-10+; |
| InChIKey | VBUVOOXRFBQXTA-HKJXASLCSA-N |
| XLogP | 5.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.80 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|