C12H14ClN — CID 91608116
N-(4-chlorohexa-1,3,5-trienyl)hexa-1,4-dien-3-imine (PubChem CID 91608116) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is N-(4-chlorohexa-1,3,5-trienyl)hexa-1,4-dien-3-imine.
| Compound Name | N-(4-chlorohexa-1,3,5-trienyl)hexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 91608116 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-(4-chlorohexa-1,3,5-trienyl)hexa-1,4-dien-3-imine |
| SMILES | C=CC(Cl)=CC=C/N=C(\C=C)C=CC |
| InChI | InChI=1S/C12H14ClN/c1-4-8-12(6-3)14-10-7-9-11(13)5-2/h4-10H,2-3H2,1H3/b8-4?,10-7?,11-9?,14-12+ |
| InChIKey | PZCPYYHHBFFKHC-WBZGCLCFSA-N |
| XLogP | 4.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|