C14H21ClFN — CID 145143816
(E)-N-[(E)-but-1-enyl]-2-[(E)-1-fluoroprop-1-enyl]-3-methylhex-2-enimidoyl chloride (PubChem CID 145143816) has the molecular formula C14H21ClFN and a molecular weight of 257.78 g/mol. Its IUPAC name is (E)-N-[(E)-but-1-enyl]-2-[(E)-1-fluoroprop-1-enyl]-3-methylhex-2-enimidoyl chloride.
| Compound Name | (E)-N-[(E)-but-1-enyl]-2-[(E)-1-fluoroprop-1-enyl]-3-methylhex-2-enimidoyl chloride |
|---|---|
| PubChem CID | 145143816 |
| Molecular Formula | C14H21ClFN |
| Molecular Weight | 257.78 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (E)-N-[(E)-but-1-enyl]-2-[(E)-1-fluoroprop-1-enyl]-3-methylhex-2-enimidoyl chloride |
| SMILES | C/C=C(F)\C(C(/Cl)=N/C=C/CC)=C(\C)CCC |
| InChI | InChI=1S/C14H21ClFN/c1-5-8-10-17-14(15)13(12(16)7-3)11(4)9-6-2/h7-8,10H,5-6,9H2,1-4H3/b10-8+,12-7+,13-11+,17-14- |
| InChIKey | ZVNNMYSFTOJDDI-UYWDQXERSA-N |
| XLogP | 5.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.78 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|