C11H19N — CID 144656062
ethane;(3Z)-N-ethenyl-4-methylhexa-3,5-dien-2-imine (PubChem CID 144656062) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is ethane;(3Z)-N-ethenyl-4-methylhexa-3,5-dien-2-imine.
| Compound Name | ethane;(3Z)-N-ethenyl-4-methylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 144656062 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | ethane;(3Z)-N-ethenyl-4-methylhexa-3,5-dien-2-imine |
| SMILES | C=C/N=C(C)/C=C(/C)C=C.CC |
| InChI | InChI=1S/C9H13N.C2H6/c1-5-8(3)7-9(4)10-6-2;1-2/h5-7H,1-2H2,3-4H3;1-2H3/b8-7-,10-9+; |
| InChIKey | QVLSTBPSYHHVCO-AXEASZOCSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|