C23H29BrN4O2 — CID 134449322
(E)-2-[6-bromo-5-(1-propan-2-ylazepan-4-yl)oxy-1H-indole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile (PubChem CID 134449322) has the molecular formula C23H29BrN4O2 and a molecular weight of 473.42 g/mol. Its IUPAC name is (E)-2-[6-bromo-5-(1-propan-2-ylazepan-4-yl)oxy-1H-indole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile.
| Compound Name | (E)-2-[6-bromo-5-(1-propan-2-ylazepan-4-yl)oxy-1H-indole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 134449322 |
| Molecular Formula | C23H29BrN4O2 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (E)-2-[6-bromo-5-(1-propan-2-ylazepan-4-yl)oxy-1H-indole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile |
| SMILES | CC(C)N1CCCC(Oc2cc3cc(C(=O)/C(C#N)=C/N(C)C)[nH]c3cc2Br)CC1 |
| InChI | InChI=1S/C23H29BrN4O2/c1-15(2)28-8-5-6-18(7-9-28)30-22-11-16-10-21(26-20(16)12-19(22)24)23(29)17(13-25)14-27(3)4/h10-12,14-15,18,26H,5-9H2,1-4H3/b17-14+ |
| InChIKey | JHFMFCRBHWJILN-SAPNQHFASA-N |
| XLogP | 4.72 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|