C23H23N5O4 — CID 134450325
6-(furan-3-yl)-N-[1-[2-(2-methoxyethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]pyridine-2-carboxamide (PubChem CID 134450325) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 6-(furan-3-yl)-N-[1-[2-(2-methoxyethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]pyridine-2-carboxamide.
| Compound Name | 6-(furan-3-yl)-N-[1-[2-(2-methoxyethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134450325 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 6-(furan-3-yl)-N-[1-[2-(2-methoxyethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]pyridine-2-carboxamide |
| SMILES | COCCOCCn1cc(NC(=O)c2cccc(-c3ccoc3)n2)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C23H23N5O4/c1-30-13-14-31-12-10-28-15-21(22(27-28)19-5-2-3-9-24-19)26-23(29)20-7-4-6-18(25-20)17-8-11-32-16-17/h2-9,11,15-16H,10,12-14H2,1H3,(H,26,29) |
| InChIKey | IGCHUSNDZRCYRI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|