C19H15Cl3N2O2 — CID 134453232
8-chloro-1-(2,6-dichlorophenyl)-5-(2-hydroxybut-3-en-2-yl)-2-methyl-1,6-naphthyridin-4-one (PubChem CID 134453232) has the molecular formula C19H15Cl3N2O2 and a molecular weight of 409.70 g/mol. Its IUPAC name is 8-chloro-1-(2,6-dichlorophenyl)-5-(2-hydroxybut-3-en-2-yl)-2-methyl-1,6-naphthyridin-4-one.
| Compound Name | 8-chloro-1-(2,6-dichlorophenyl)-5-(2-hydroxybut-3-en-2-yl)-2-methyl-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 134453232 |
| Molecular Formula | C19H15Cl3N2O2 |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 8-chloro-1-(2,6-dichlorophenyl)-5-(2-hydroxybut-3-en-2-yl)-2-methyl-1,6-naphthyridin-4-one |
| SMILES | C=CC(C)(O)c1ncc(Cl)c2c1c(=O)cc(C)n2-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H15Cl3N2O2/c1-4-19(3,26)18-15-14(25)8-10(2)24(17(15)13(22)9-23-18)16-11(20)6-5-7-12(16)21/h4-9,26H,1H2,2-3H3 |
| InChIKey | BBBUPTYAKQCONJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|