C17H10Cl4N2O — CID 160664174
5,8-dichloro-2-cyclopropyl-1-(2,6-dichlorophenyl)-1,6-naphthyridin-4-one (PubChem CID 160664174) has the molecular formula C17H10Cl4N2O and a molecular weight of 400.09 g/mol. Its IUPAC name is 5,8-dichloro-2-cyclopropyl-1-(2,6-dichlorophenyl)-1,6-naphthyridin-4-one.
| Compound Name | 5,8-dichloro-2-cyclopropyl-1-(2,6-dichlorophenyl)-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 160664174 |
| Molecular Formula | C17H10Cl4N2O |
| Molecular Weight | 400.09 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 5,8-dichloro-2-cyclopropyl-1-(2,6-dichlorophenyl)-1,6-naphthyridin-4-one |
| SMILES | O=c1cc(C2CC2)n(-c2c(Cl)cccc2Cl)c2c(Cl)cnc(Cl)c12 |
| InChI | InChI=1S/C17H10Cl4N2O/c18-9-2-1-3-10(19)15(9)23-12(8-4-5-8)6-13(24)14-16(23)11(20)7-22-17(14)21/h1-3,6-8H,4-5H2 |
| InChIKey | RMBLPNCFPFRNIR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.09 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|