C23H20N4O — CID 134455634
N-[2-methoxy-3-(5-methyl-1,2,4-triazol-1-yl)phenyl]-1,1-diphenylmethanimine (PubChem CID 134455634) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[2-methoxy-3-(5-methyl-1,2,4-triazol-1-yl)phenyl]-1,1-diphenylmethanimine.
| Compound Name | N-[2-methoxy-3-(5-methyl-1,2,4-triazol-1-yl)phenyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 134455634 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[2-methoxy-3-(5-methyl-1,2,4-triazol-1-yl)phenyl]-1,1-diphenylmethanimine |
| SMILES | COc1c(N=C(c2ccccc2)c2ccccc2)cccc1-n1ncnc1C |
| InChI | InChI=1S/C23H20N4O/c1-17-24-16-25-27(17)21-15-9-14-20(23(21)28-2)26-22(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-16H,1-2H3 |
| InChIKey | FJFUVAOGQOFADE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|