C19H20ClF2N5O3S — CID 134456709
N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]methanesulfonamide (PubChem CID 134456709) has the molecular formula C19H20ClF2N5O3S and a molecular weight of 471.92 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]methanesulfonamide.
| Compound Name | N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 134456709 |
| Molecular Formula | C19H20ClF2N5O3S |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2C1CCCCO1 |
| InChI | InChI=1S/C19H20ClF2N5O3S/c1-31(28,29)26-12-7-3-2-6-11(12)23-13-10-14(20)24-18-16(13)25-19(17(21)22)27(18)15-8-4-5-9-30-15/h2-3,6-7,10,15,17,26H,4-5,8-9H2,1H3,(H,23,24) |
| InChIKey | GUKAYQBASXDTNG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|