C20H18ClF2N5O2 — CID 134456295
3-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzonitrile (PubChem CID 134456295) has the molecular formula C20H18ClF2N5O2 and a molecular weight of 433.85 g/mol. Its IUPAC name is 3-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzonitrile.
| Compound Name | 3-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 134456295 |
| Molecular Formula | C20H18ClF2N5O2 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 3-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzonitrile |
| SMILES | COc1c(C#N)cccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2C1CCCCO1 |
| InChI | InChI=1S/C20H18ClF2N5O2/c1-29-17-11(10-24)5-4-6-12(17)25-13-9-14(21)26-19-16(13)27-20(18(22)23)28(19)15-7-2-3-8-30-15/h4-6,9,15,18H,2-3,7-8H2,1H3,(H,25,26) |
| InChIKey | IHAKPCAWNHCMTE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|