C19H20ClF2IN7OP — CID 142334704
5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]imidazo[4,5-b]pyridin-7-amine;ethane (PubChem CID 142334704) has the molecular formula C19H20ClF2IN7OP and a molecular weight of 593.74 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]imidazo[4,5-b]pyridin-7-amine;ethane.
| Compound Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]imidazo[4,5-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 142334704 |
| Molecular Formula | C19H20ClF2IN7OP |
| Molecular Weight | 593.74 g/mol |
| Exact Mass | 593.02 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]imidazo[4,5-b]pyridin-7-amine;ethane |
| SMILES | CC.COc1c(Nc2cc(Cl)nc3c2nc(C(F)F)n3PI)cccc1-c1ncn(C)n1 |
| InChI | InChI=1S/C17H14ClF2IN7OP.C2H6/c1-27-7-22-15(26-27)8-4-3-5-9(13(8)29-2)23-10-6-11(18)24-16-12(10)25-17(14(19)20)28(16)30-21;1-2/h3-7,14,30H,1-2H3,(H,23,24);1-2H3 |
| InChIKey | GDRSLMSMJAXXFL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|