C22H29ClF2IN6OP — CID 142334529
5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[2-methoxy-3-(1-methylpyrazol-3-yl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridin-7-amine;ethane (PubChem CID 142334529) has the molecular formula C22H29ClF2IN6OP and a molecular weight of 624.84 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[2-methoxy-3-(1-methylpyrazol-3-yl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridin-7-amine;ethane.
| Compound Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[2-methoxy-3-(1-methylpyrazol-3-yl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 142334529 |
| Molecular Formula | C22H29ClF2IN6OP |
| Molecular Weight | 624.84 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[2-methoxy-3-(1-methylpyrazol-3-yl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridin-7-amine;ethane |
| SMILES | CC.CC.COc1c(Nc2cc(Cl)nc3c2NC(C(F)F)N3PI)cccc1-c1ccn(C)n1 |
| InChI | InChI=1S/C18H17ClF2IN6OP.2C2H6/c1-27-7-6-10(26-27)9-4-3-5-11(15(9)29-2)23-12-8-13(19)24-17-14(12)25-18(16(20)21)28(17)30-22;2*1-2/h3-8,16,18,25,30H,1-2H3,(H,23,24);2*1-2H3 |
| InChIKey | UJBCIGRUMBXQGG-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.84 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|