C18H17ClN6O2 — CID 134438612
6-chloro-4-[2-methoxy-3-(1-methylpyrazol-3-yl)anilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 134438612) has the molecular formula C18H17ClN6O2 and a molecular weight of 384.83 g/mol. Its IUPAC name is 6-chloro-4-[2-methoxy-3-(1-methylpyrazol-3-yl)anilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-chloro-4-[2-methoxy-3-(1-methylpyrazol-3-yl)anilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 134438612 |
| Molecular Formula | C18H17ClN6O2 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 6-chloro-4-[2-methoxy-3-(1-methylpyrazol-3-yl)anilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(Nc2cc(Cl)nc3[nH]n(C)c(=O)c23)cccc1-c1ccn(C)n1 |
| InChI | InChI=1S/C18H17ClN6O2/c1-24-8-7-11(22-24)10-5-4-6-12(16(10)27-3)20-13-9-14(19)21-17-15(13)18(26)25(2)23-17/h4-9H,1-3H3,(H2,20,21,23) |
| InChIKey | DJOGCJQJZAEIFL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|