C19H20N6O3S — CID 163567456
2-methyl-6-[(1-methylpyrazol-3-yl)methyl]-4-(2-methylsulfonylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 163567456) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is 2-methyl-6-[(1-methylpyrazol-3-yl)methyl]-4-(2-methylsulfonylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 2-methyl-6-[(1-methylpyrazol-3-yl)methyl]-4-(2-methylsulfonylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 163567456 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-methyl-6-[(1-methylpyrazol-3-yl)methyl]-4-(2-methylsulfonylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cn1ccc(Cc2cc(Nc3ccccc3S(C)(=O)=O)c3c(=O)n(C)[nH]c3n2)n1 |
| InChI | InChI=1S/C19H20N6O3S/c1-24-9-8-12(22-24)10-13-11-15(17-18(20-13)23-25(2)19(17)26)21-14-6-4-5-7-16(14)29(3,27)28/h4-9,11H,10H2,1-3H3,(H2,20,21,23) |
| InChIKey | GZOSSXUUVITTLS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|