C22H22N6O3S — CID 134438980
6-[(6-cyclopropyl-2-pyridinyl)amino]-2-methyl-4-(2-methylsulfonylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 134438980) has the molecular formula C22H22N6O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is 6-[(6-cyclopropyl-2-pyridinyl)amino]-2-methyl-4-(2-methylsulfonylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-[(6-cyclopropyl-2-pyridinyl)amino]-2-methyl-4-(2-methylsulfonylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 134438980 |
| Molecular Formula | C22H22N6O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 6-[(6-cyclopropyl-2-pyridinyl)amino]-2-methyl-4-(2-methylsulfonylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cn1[nH]c2nc(Nc3cccc(C4CC4)n3)cc(Nc3ccccc3S(C)(=O)=O)c2c1=O |
| InChI | InChI=1S/C22H22N6O3S/c1-28-22(29)20-16(23-15-6-3-4-8-17(15)32(2,30)31)12-19(26-21(20)27-28)25-18-9-5-7-14(24-18)13-10-11-13/h3-9,12-13H,10-11H2,1-2H3,(H3,23,24,25,26,27) |
| InChIKey | KXMWDYJKFXLMDK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|