C24H28N10O2 — CID 166647436
N'-[amino(methyl)amino]-3-[[6-[(6-cyclopropyl-2-pyridinyl)amino]-2-methyl-3-oxo-1H-pyrazolo[3,4-b]pyridin-4-yl]amino]-2-methoxybenzenecarboximidamide (PubChem CID 166647436) has the molecular formula C24H28N10O2 and a molecular weight of 488.56 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-3-[[6-[(6-cyclopropyl-2-pyridinyl)amino]-2-methyl-3-oxo-1H-pyrazolo[3,4-b]pyridin-4-yl]amino]-2-methoxybenzenecarboximidamide.
| Compound Name | N'-[amino(methyl)amino]-3-[[6-[(6-cyclopropyl-2-pyridinyl)amino]-2-methyl-3-oxo-1H-pyrazolo[3,4-b]pyridin-4-yl]amino]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 166647436 |
| Molecular Formula | C24H28N10O2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N'-[amino(methyl)amino]-3-[[6-[(6-cyclopropyl-2-pyridinyl)amino]-2-methyl-3-oxo-1H-pyrazolo[3,4-b]pyridin-4-yl]amino]-2-methoxybenzenecarboximidamide |
| SMILES | COc1c(Nc2cc(Nc3cccc(C4CC4)n3)nc3[nH]n(C)c(=O)c23)cccc1/C(N)=N/N(C)N |
| InChI | InChI=1S/C24H28N10O2/c1-33-24(35)20-17(27-16-8-4-6-14(21(16)36-3)22(25)31-34(2)26)12-19(30-23(20)32-33)29-18-9-5-7-15(28-18)13-10-11-13/h4-9,12-13H,10-11,26H2,1-3H3,(H2,25,31)(H3,27,28,29,30,32) |
| InChIKey | KSMLNHBIHMJUAX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|