C22H21N7O3 — CID 162478635
6-[(6-isocyano-2-pyridinyl)amino]-4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 162478635) has the molecular formula C22H21N7O3 and a molecular weight of 431.46 g/mol. Its IUPAC name is 6-[(6-isocyano-2-pyridinyl)amino]-4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-[(6-isocyano-2-pyridinyl)amino]-4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 162478635 |
| Molecular Formula | C22H21N7O3 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 6-[(6-isocyano-2-pyridinyl)amino]-4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | [C-]#[N+]c1cccc(Nc2cc(Nc3ccc(COC)cc3OC)c3c(=O)n(C)[nH]c3n2)n1 |
| InChI | InChI=1S/C22H21N7O3/c1-23-17-6-5-7-18(25-17)26-19-11-15(20-21(27-19)28-29(2)22(20)30)24-14-9-8-13(12-31-3)10-16(14)32-4/h5-11H,12H2,2-4H3,(H3,24,25,26,27,28) |
| InChIKey | ZXLKMMQYUJYTPF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|