C18H25ClN4O3 — CID 142329881
2-amino-6-chloro-4-[2-methoxy-4-(methoxymethyl)anilino]-N-methylpyridine-3-carboxamide;ethane (PubChem CID 142329881) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-amino-6-chloro-4-[2-methoxy-4-(methoxymethyl)anilino]-N-methylpyridine-3-carboxamide;ethane.
| Compound Name | 2-amino-6-chloro-4-[2-methoxy-4-(methoxymethyl)anilino]-N-methylpyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 142329881 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-amino-6-chloro-4-[2-methoxy-4-(methoxymethyl)anilino]-N-methylpyridine-3-carboxamide;ethane |
| SMILES | CC.CNC(=O)c1c(Nc2ccc(COC)cc2OC)cc(Cl)nc1N |
| InChI | InChI=1S/C16H19ClN4O3.C2H6/c1-19-16(22)14-11(7-13(17)21-15(14)18)20-10-5-4-9(8-23-2)6-12(10)24-3;1-2/h4-7H,8H2,1-3H3,(H,19,22)(H3,18,20,21);1-2H3 |
| InChIKey | UIFFYYJQZZTBGA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|