C17H15ClN6O2 — CID 142329790
6-chloro-4-[3-(1H-imidazol-5-yl)-2-methoxyanilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 142329790) has the molecular formula C17H15ClN6O2 and a molecular weight of 370.80 g/mol. Its IUPAC name is 6-chloro-4-[3-(1H-imidazol-5-yl)-2-methoxyanilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-chloro-4-[3-(1H-imidazol-5-yl)-2-methoxyanilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 142329790 |
| Molecular Formula | C17H15ClN6O2 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 6-chloro-4-[3-(1H-imidazol-5-yl)-2-methoxyanilino]-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(Nc2cc(Cl)nc3[nH]n(C)c(=O)c23)cccc1-c1cnc[nH]1 |
| InChI | InChI=1S/C17H15ClN6O2/c1-24-17(25)14-11(6-13(18)22-16(14)23-24)21-10-5-3-4-9(15(10)26-2)12-7-19-8-20-12/h3-8H,1-2H3,(H,19,20)(H2,21,22,23) |
| InChIKey | LSFXRECHTVJNAQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|