C14H14ClFN4O — CID 166647538
6-chloro-N-(3-fluoro-2-methoxyphenyl)-2-methyl-1,3-dihydropyrazolo[3,4-b]pyridin-4-amine (PubChem CID 166647538) has the molecular formula C14H14ClFN4O and a molecular weight of 308.74 g/mol. Its IUPAC name is 6-chloro-N-(3-fluoro-2-methoxyphenyl)-2-methyl-1,3-dihydropyrazolo[3,4-b]pyridin-4-amine.
| Compound Name | 6-chloro-N-(3-fluoro-2-methoxyphenyl)-2-methyl-1,3-dihydropyrazolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 166647538 |
| Molecular Formula | C14H14ClFN4O |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 6-chloro-N-(3-fluoro-2-methoxyphenyl)-2-methyl-1,3-dihydropyrazolo[3,4-b]pyridin-4-amine |
| SMILES | COc1c(F)cccc1Nc1cc(Cl)nc2c1CN(C)N2 |
| InChI | InChI=1S/C14H14ClFN4O/c1-20-7-8-11(6-12(15)18-14(8)19-20)17-10-5-3-4-9(16)13(10)21-2/h3-6H,7H2,1-2H3,(H2,17,18,19) |
| InChIKey | KGHNLJBDNVATIV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|