C19H19ClN6O2 — CID 160808659
2-chloro-4-[3-(4,5-dimethyltriazol-2-yl)-2-methoxyanilino]-6-methyl-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 160808659) has the molecular formula C19H19ClN6O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is 2-chloro-4-[3-(4,5-dimethyltriazol-2-yl)-2-methoxyanilino]-6-methyl-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 2-chloro-4-[3-(4,5-dimethyltriazol-2-yl)-2-methoxyanilino]-6-methyl-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 160808659 |
| Molecular Formula | C19H19ClN6O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-chloro-4-[3-(4,5-dimethyltriazol-2-yl)-2-methoxyanilino]-6-methyl-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1c(Nc2cc(Cl)nc3c2C(=O)N(C)C3)cccc1-n1nc(C)c(C)n1 |
| InChI | InChI=1S/C19H19ClN6O2/c1-10-11(2)24-26(23-10)15-7-5-6-12(18(15)28-4)21-13-8-16(20)22-14-9-25(3)19(27)17(13)14/h5-8H,9H2,1-4H3,(H,21,22) |
| InChIKey | MUNXGJDNWPAWEF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|