C23H28ClF2IN5PS2 — CID 142335052
5-chloro-2-(difluoromethyl)-N-[4-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine;ethane (PubChem CID 142335052) has the molecular formula C23H28ClF2IN5PS2 and a molecular weight of 669.97 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-N-[4-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine;ethane.
| Compound Name | 5-chloro-2-(difluoromethyl)-N-[4-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 142335052 |
| Molecular Formula | C23H28ClF2IN5PS2 |
| Molecular Weight | 669.97 g/mol |
| Exact Mass | 669.02 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-N-[4-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine;ethane |
| SMILES | CC.CC.CSc1cc(-c2nc(C)c(C)s2)ccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2PI |
| InChI | InChI=1S/C19H16ClF2IN5PS2.2C2H6/c1-8-9(2)31-19(24-8)10-4-5-11(13(6-10)30-3)25-12-7-14(20)26-17-15(12)27-18(16(21)22)28(17)29-23;2*1-2/h4-7,16,29H,1-3H3,(H,25,26);2*1-2H3 |
| InChIKey | ROMSNKHIYGOKGR-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.97 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|