C21H25ClF2IN6PS — CID 142334852
5-chloro-2-(difluoromethyl)-N-[4-[(E)-N-(dimethylamino)-C-ethenylcarbonimidoyl]-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine;ethane (PubChem CID 142334852) has the molecular formula C21H25ClF2IN6PS and a molecular weight of 624.87 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-N-[4-[(E)-N-(dimethylamino)-C-ethenylcarbonimidoyl]-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine;ethane.
| Compound Name | 5-chloro-2-(difluoromethyl)-N-[4-[(E)-N-(dimethylamino)-C-ethenylcarbonimidoyl]-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 142334852 |
| Molecular Formula | C21H25ClF2IN6PS |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.03 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-N-[4-[(E)-N-(dimethylamino)-C-ethenylcarbonimidoyl]-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine;ethane |
| SMILES | C=C/C(=N\N(C)C)c1ccc(Nc2cc(Cl)nc3c2nc(C(F)F)n3PI)c(SC)c1.CC |
| InChI | InChI=1S/C19H19ClF2IN6PS.C2H6/c1-5-11(27-28(2)3)10-6-7-12(14(8-10)31-4)24-13-9-15(20)25-18-16(13)26-19(17(21)22)29(18)30-23;1-2/h5-9,17,30H,1H2,2-4H3,(H,24,25);1-2H3/b27-11+; |
| InChIKey | LKJHJDWOVKPOMW-WVNJMUEZSA-N |
| XLogP | 7.76 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|