C14H17ClF2IN4P — CID 142334409
5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[(2E)-penta-2,4-dien-2-yl]imidazo[4,5-b]pyridin-7-amine;ethane (PubChem CID 142334409) has the molecular formula C14H17ClF2IN4P and a molecular weight of 472.65 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[(2E)-penta-2,4-dien-2-yl]imidazo[4,5-b]pyridin-7-amine;ethane.
| Compound Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[(2E)-penta-2,4-dien-2-yl]imidazo[4,5-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 142334409 |
| Molecular Formula | C14H17ClF2IN4P |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[(2E)-penta-2,4-dien-2-yl]imidazo[4,5-b]pyridin-7-amine;ethane |
| SMILES | C=C/C=C(\C)Nc1cc(Cl)nc2c1nc(C(F)F)n2PI.CC |
| InChI | InChI=1S/C12H11ClF2IN4P.C2H6/c1-3-4-6(2)17-7-5-8(13)18-11-9(7)19-12(10(14)15)20(11)21-16;1-2/h3-5,10,21H,1H2,2H3,(H,17,18);1-2H3/b6-4+; |
| InChIKey | DIBHJNLLIBKLEN-CVDVRWGVSA-N |
| XLogP | 6.34 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|