C21H27ClF2IN4OPS — CID 142334795
5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-(2-methylsulfanylphenyl)imidazo[4,5-b]pyridin-7-amine;ethane;oxane (PubChem CID 142334795) has the molecular formula C21H27ClF2IN4OPS and a molecular weight of 614.87 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-(2-methylsulfanylphenyl)imidazo[4,5-b]pyridin-7-amine;ethane;oxane.
| Compound Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-(2-methylsulfanylphenyl)imidazo[4,5-b]pyridin-7-amine;ethane;oxane |
|---|---|
| PubChem CID | 142334795 |
| Molecular Formula | C21H27ClF2IN4OPS |
| Molecular Weight | 614.87 g/mol |
| Exact Mass | 614.03 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-(2-methylsulfanylphenyl)imidazo[4,5-b]pyridin-7-amine;ethane;oxane |
| SMILES | C1CCOCC1.CC.CSc1ccccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2PI |
| InChI | InChI=1S/C14H11ClF2IN4PS.C5H10O.C2H6/c1-24-9-5-3-2-4-7(9)19-8-6-10(15)20-13-11(8)21-14(12(16)17)22(13)23-18;1-2-4-6-5-3-1;1-2/h2-6,12,23H,1H3,(H,19,20);1-5H2;1-2H3 |
| InChIKey | ARVMAXPUYZGMQX-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.87 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|