C20H25ClIN4OPS — CID 142334078
5-chloro-3-iodophosphanyl-2-methyl-N-[2-methylsulfanyl-4-(oxolan-3-yl)phenyl]imidazo[4,5-b]pyridin-7-amine;ethane (PubChem CID 142334078) has the molecular formula C20H25ClIN4OPS and a molecular weight of 562.85 g/mol. Its IUPAC name is 5-chloro-3-iodophosphanyl-2-methyl-N-[2-methylsulfanyl-4-(oxolan-3-yl)phenyl]imidazo[4,5-b]pyridin-7-amine;ethane.
| Compound Name | 5-chloro-3-iodophosphanyl-2-methyl-N-[2-methylsulfanyl-4-(oxolan-3-yl)phenyl]imidazo[4,5-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 142334078 |
| Molecular Formula | C20H25ClIN4OPS |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 5-chloro-3-iodophosphanyl-2-methyl-N-[2-methylsulfanyl-4-(oxolan-3-yl)phenyl]imidazo[4,5-b]pyridin-7-amine;ethane |
| SMILES | CC.CSc1cc(C2CCOC2)ccc1Nc1cc(Cl)nc2c1nc(C)n2PI |
| InChI | InChI=1S/C18H19ClIN4OPS.C2H6/c1-10-21-17-14(8-16(19)23-18(17)24(10)26-20)22-13-4-3-11(7-15(13)27-2)12-5-6-25-9-12;1-2/h3-4,7-8,12,26H,5-6,9H2,1-2H3,(H,22,23);1-2H3 |
| InChIKey | AZSNTDSNTVGEQX-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|