C25H35IN5O2PS — CID 142334468
ethane;N-[3-iodophosphanyl-2-methyl-7-[2-methylsulfanyl-4-(oxolan-2-yl)anilino]imidazo[4,5-b]pyridin-5-yl]formamide;methylcyclopropane (PubChem CID 142334468) has the molecular formula C25H35IN5O2PS and a molecular weight of 627.53 g/mol. Its IUPAC name is ethane;N-[3-iodophosphanyl-2-methyl-7-[2-methylsulfanyl-4-(oxolan-2-yl)anilino]imidazo[4,5-b]pyridin-5-yl]formamide;methylcyclopropane.
| Compound Name | ethane;N-[3-iodophosphanyl-2-methyl-7-[2-methylsulfanyl-4-(oxolan-2-yl)anilino]imidazo[4,5-b]pyridin-5-yl]formamide;methylcyclopropane |
|---|---|
| PubChem CID | 142334468 |
| Molecular Formula | C25H35IN5O2PS |
| Molecular Weight | 627.53 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | ethane;N-[3-iodophosphanyl-2-methyl-7-[2-methylsulfanyl-4-(oxolan-2-yl)anilino]imidazo[4,5-b]pyridin-5-yl]formamide;methylcyclopropane |
| SMILES | CC.CC1CC1.CSc1cc(C2CCCO2)ccc1Nc1cc(NC=O)nc2c1nc(C)n2PI |
| InChI | InChI=1S/C19H21IN5O2PS.C4H8.C2H6/c1-11-22-18-14(9-17(21-10-26)24-19(18)25(11)28-20)23-13-6-5-12(8-16(13)29-2)15-4-3-7-27-15;1-4-2-3-4;1-2/h5-6,8-10,15,28H,3-4,7H2,1-2H3,(H2,21,23,24,26);4H,2-3H2,1H3;1-2H3 |
| InChIKey | RZHOXIKBTAZPMA-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.53 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|