C20H17IN7PS — CID 142334196
6-[[3-iodophosphanyl-2-methyl-7-(2-methylsulfanylanilino)imidazo[4,5-b]pyridin-5-yl]amino]pyridine-2-carbonitrile (PubChem CID 142334196) has the molecular formula C20H17IN7PS and a molecular weight of 545.35 g/mol. Its IUPAC name is 6-[[3-iodophosphanyl-2-methyl-7-(2-methylsulfanylanilino)imidazo[4,5-b]pyridin-5-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 6-[[3-iodophosphanyl-2-methyl-7-(2-methylsulfanylanilino)imidazo[4,5-b]pyridin-5-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 142334196 |
| Molecular Formula | C20H17IN7PS |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 545.00 |
| IUPAC Name | 6-[[3-iodophosphanyl-2-methyl-7-(2-methylsulfanylanilino)imidazo[4,5-b]pyridin-5-yl]amino]pyridine-2-carbonitrile |
| SMILES | CSc1ccccc1Nc1cc(Nc2cccc(C#N)n2)nc2c1nc(C)n2PI |
| InChI | InChI=1S/C20H17IN7PS/c1-12-23-19-15(25-14-7-3-4-8-16(14)30-2)10-18(27-20(19)28(12)29-21)26-17-9-5-6-13(11-22)24-17/h3-10,29H,1-2H3,(H2,24,25,26,27) |
| InChIKey | MBRZHINHRVWWBM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|