C18H17ClIN6PS — CID 142334162
5-chloro-3-iodophosphanyl-2-methyl-N-[4-(1-methylimidazol-4-yl)-2-methylsulfanylphenyl]imidazo[4,5-b]pyridin-7-amine (PubChem CID 142334162) has the molecular formula C18H17ClIN6PS and a molecular weight of 542.77 g/mol. Its IUPAC name is 5-chloro-3-iodophosphanyl-2-methyl-N-[4-(1-methylimidazol-4-yl)-2-methylsulfanylphenyl]imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-3-iodophosphanyl-2-methyl-N-[4-(1-methylimidazol-4-yl)-2-methylsulfanylphenyl]imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 142334162 |
| Molecular Formula | C18H17ClIN6PS |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 5-chloro-3-iodophosphanyl-2-methyl-N-[4-(1-methylimidazol-4-yl)-2-methylsulfanylphenyl]imidazo[4,5-b]pyridin-7-amine |
| SMILES | CSc1cc(-c2cn(C)cn2)ccc1Nc1cc(Cl)nc2c1nc(C)n2PI |
| InChI | InChI=1S/C18H17ClIN6PS/c1-10-22-17-13(7-16(19)24-18(17)26(10)27-20)23-12-5-4-11(6-15(12)28-3)14-8-25(2)9-21-14/h4-9,27H,1-3H3,(H,23,24) |
| InChIKey | TWKSLANYVZLXRY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|