C14H10Cl2F2IN4PS — CID 142334712
5-chloro-N-(4-chloro-2-methylsulfanylphenyl)-2-(difluoromethyl)-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine (PubChem CID 142334712) has the molecular formula C14H10Cl2F2IN4PS and a molecular weight of 533.11 g/mol. Its IUPAC name is 5-chloro-N-(4-chloro-2-methylsulfanylphenyl)-2-(difluoromethyl)-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-(4-chloro-2-methylsulfanylphenyl)-2-(difluoromethyl)-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 142334712 |
| Molecular Formula | C14H10Cl2F2IN4PS |
| Molecular Weight | 533.11 g/mol |
| Exact Mass | 531.88 |
| IUPAC Name | 5-chloro-N-(4-chloro-2-methylsulfanylphenyl)-2-(difluoromethyl)-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine |
| SMILES | CSc1cc(Cl)ccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2PI |
| InChI | InChI=1S/C14H10Cl2F2IN4PS/c1-25-9-4-6(15)2-3-7(9)20-8-5-10(16)21-13-11(8)22-14(12(17)18)23(13)24-19/h2-5,12,24H,1H3,(H,20,21) |
| InChIKey | GJIXATMSSLRYPW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.11 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|