C18H21F5 — CID 134457069
3,3,4,5,6-pentafluoro-2-(4-propylcyclohexyl)-1,2-dihydroindene (PubChem CID 134457069) has the molecular formula C18H21F5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3,3,4,5,6-pentafluoro-2-(4-propylcyclohexyl)-1,2-dihydroindene.
| Compound Name | 3,3,4,5,6-pentafluoro-2-(4-propylcyclohexyl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 134457069 |
| Molecular Formula | C18H21F5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3,3,4,5,6-pentafluoro-2-(4-propylcyclohexyl)-1,2-dihydroindene |
| SMILES | CCCC1CCC(C2Cc3cc(F)c(F)c(F)c3C2(F)F)CC1 |
| InChI | InChI=1S/C18H21F5/c1-2-3-10-4-6-11(7-5-10)13-8-12-9-14(19)16(20)17(21)15(12)18(13,22)23/h9-11,13H,2-8H2,1H3 |
| InChIKey | XXTXKFKMKJXCOF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|