C22H29F3O — CID 19387599
6-(4-propylcyclohexyl)-2-(3,4,5-trifluorophenyl)spiro[3.3]heptan-2-ol (PubChem CID 19387599) has the molecular formula C22H29F3O and a molecular weight of 366.47 g/mol. Its IUPAC name is 6-(4-propylcyclohexyl)-2-(3,4,5-trifluorophenyl)spiro[3.3]heptan-2-ol.
| Compound Name | 6-(4-propylcyclohexyl)-2-(3,4,5-trifluorophenyl)spiro[3.3]heptan-2-ol |
|---|---|
| PubChem CID | 19387599 |
| Molecular Formula | C22H29F3O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 6-(4-propylcyclohexyl)-2-(3,4,5-trifluorophenyl)spiro[3.3]heptan-2-ol |
| SMILES | CCCC1CCC(C2CC3(C2)CC(O)(c2cc(F)c(F)c(F)c2)C3)CC1 |
| InChI | InChI=1S/C22H29F3O/c1-2-3-14-4-6-15(7-5-14)16-10-21(11-16)12-22(26,13-21)17-8-18(23)20(25)19(24)9-17/h8-9,14-16,26H,2-7,10-13H2,1H3 |
| InChIKey | HYCOFJQIEYAAKK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|