C16H13NO2S2 — CID 134460914
5-[(4-methylphenyl)sulfanylamino]-1-benzothiophene-2-carboxylic acid (PubChem CID 134460914) has the molecular formula C16H13NO2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 5-[(4-methylphenyl)sulfanylamino]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5-[(4-methylphenyl)sulfanylamino]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 134460914 |
| Molecular Formula | C16H13NO2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 5-[(4-methylphenyl)sulfanylamino]-1-benzothiophene-2-carboxylic acid |
| SMILES | Cc1ccc(SNc2ccc3sc(C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C16H13NO2S2/c1-10-2-5-13(6-3-10)21-17-12-4-7-14-11(8-12)9-15(20-14)16(18)19/h2-9,17H,1H3,(H,18,19) |
| InChIKey | HNVMRTRLPZFKQQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|